C21H23N3O3 — CID 51476588
[(6S)-6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl]-pyrazin-2-ylmethanone (PubChem CID 51476588) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is [(6S)-6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(6S)-6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 51476588 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | [(6S)-6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl]-pyrazin-2-ylmethanone |
| SMILES | C[C@H]1c2cc3c(cc2C2(CCCC2)CN1C(=O)c1cnccn1)OCCO3 |
| InChI | InChI=1S/C21H23N3O3/c1-14-15-10-18-19(27-9-8-26-18)11-16(15)21(4-2-3-5-21)13-24(14)20(25)17-12-22-6-7-23-17/h6-7,10-12,14H,2-5,8-9,13H2,1H3/t14-/m0/s1 |
| InChIKey | AAUMYDGLAOVNOA-AWEZNQCLSA-N |
| XLogP | 3.28 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |