C25H27N5O3 — CID 55526599
1-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)-2-(5-phenyltetrazol-2-yl)ethanone (PubChem CID 55526599) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is 1-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)-2-(5-phenyltetrazol-2-yl)ethanone.
| Compound Name | 1-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)-2-(5-phenyltetrazol-2-yl)ethanone |
|---|---|
| PubChem CID | 55526599 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 1-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)-2-(5-phenyltetrazol-2-yl)ethanone |
| SMILES | CC1c2cc3c(cc2C2(CCCC2)CN1C(=O)Cn1nnc(-c2ccccc2)n1)OCCO3 |
| InChI | InChI=1S/C25H27N5O3/c1-17-19-13-21-22(33-12-11-32-21)14-20(19)25(9-5-6-10-25)16-29(17)23(31)15-30-27-24(26-28-30)18-7-3-2-4-8-18/h2-4,7-8,13-14,17H,5-6,9-12,15-16H2,1H3 |
| InChIKey | GTHDWNPQKVPYCP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |