C21H30N2O4 — CID 96543330
(6S)-N-[(2S)-1-methoxypropan-2-yl]-6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-carboxamide (PubChem CID 96543330) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is (6S)-N-[(2S)-1-methoxypropan-2-yl]-6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-carboxamide.
| Compound Name | (6S)-N-[(2S)-1-methoxypropan-2-yl]-6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-carboxamide |
|---|---|
| PubChem CID | 96543330 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | (6S)-N-[(2S)-1-methoxypropan-2-yl]-6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-carboxamide |
| SMILES | COC[C@H](C)NC(=O)N1CC2(CCCC2)c2cc3c(cc2[C@@H]1C)OCCO3 |
| InChI | InChI=1S/C21H30N2O4/c1-14(12-25-3)22-20(24)23-13-21(6-4-5-7-21)17-11-19-18(26-8-9-27-19)10-16(17)15(23)2/h10-11,14-15H,4-9,12-13H2,1-3H3,(H,22,24)/t14-,15-/m0/s1 |
| InChIKey | CWCLRBIZVXOHGY-GJZGRUSLSA-N |
| XLogP | 3.39 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |