C23H25FN2O2S — CID 166199988
N-(2-fluorophenyl)-6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-carbothioamide (PubChem CID 166199988) has the molecular formula C23H25FN2O2S and a molecular weight of 412.53 g/mol. Its IUPAC name is N-(2-fluorophenyl)-6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-carbothioamide.
| Compound Name | N-(2-fluorophenyl)-6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-carbothioamide |
|---|---|
| PubChem CID | 166199988 |
| Molecular Formula | C23H25FN2O2S |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-(2-fluorophenyl)-6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-carbothioamide |
| SMILES | CC1c2cc3c(cc2C2(CCCC2)CN1C(=S)Nc1ccccc1F)OCCO3 |
| InChI | InChI=1S/C23H25FN2O2S/c1-15-16-12-20-21(28-11-10-27-20)13-17(16)23(8-4-5-9-23)14-26(15)22(29)25-19-7-3-2-6-18(19)24/h2-3,6-7,12-13,15H,4-5,8-11,14H2,1H3,(H,25,29) |
| InChIKey | XDLWIKMVDFYBDD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|