C27H32N2O5S — CID 55678419
N-ethyl-4-[(E)-3-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)-3-oxoprop-1-enyl]benzenesulfonamide (PubChem CID 55678419) has the molecular formula C27H32N2O5S and a molecular weight of 496.63 g/mol. Its IUPAC name is N-ethyl-4-[(E)-3-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)-3-oxoprop-1-enyl]benzenesulfonamide.
| Compound Name | N-ethyl-4-[(E)-3-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)-3-oxoprop-1-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55678419 |
| Molecular Formula | C27H32N2O5S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | N-ethyl-4-[(E)-3-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)-3-oxoprop-1-enyl]benzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(/C=C/C(=O)N2CC3(CCCC3)c3cc4c(cc3C2C)OCCO4)cc1 |
| InChI | InChI=1S/C27H32N2O5S/c1-3-28-35(31,32)21-9-6-20(7-10-21)8-11-26(30)29-18-27(12-4-5-13-27)23-17-25-24(33-14-15-34-25)16-22(23)19(29)2/h6-11,16-17,19,28H,3-5,12-15,18H2,1-2H3/b11-8+ |
| InChIKey | CTYURZKZDOQWNN-DHZHZOJOSA-N |
| XLogP | 4.18 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|