C22H25N3O2S — CID 52502310
(6R)-7-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane] (PubChem CID 52502310) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is (6R)-7-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane].
| Compound Name | (6R)-7-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane] |
|---|---|
| PubChem CID | 52502310 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (6R)-7-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane] |
| SMILES | C[C@@H]1c2cc3c(cc2C2(CCCC2)CN1Cc1cn2ccsc2n1)OCCO3 |
| InChI | InChI=1S/C22H25N3O2S/c1-15-17-10-19-20(27-8-7-26-19)11-18(17)22(4-2-3-5-22)14-25(15)13-16-12-24-6-9-28-21(24)23-16/h6,9-12,15H,2-5,7-8,13-14H2,1H3/t15-/m1/s1 |
| InChIKey | QWMSSZBXCOUCIK-OAHLLOKOSA-N |
| XLogP | 4.56 |
| TPSA | 39.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |