C23H28N2O4S — CID 60507100
ethyl 4-[(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)methyl]-1,3-thiazole-2-carboxylate (PubChem CID 60507100) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is ethyl 4-[(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)methyl]-1,3-thiazole-2-carboxylate.
| Compound Name | ethyl 4-[(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)methyl]-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 60507100 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | ethyl 4-[(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)methyl]-1,3-thiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nc(CN2CC3(CCCC3)c3cc4c(cc3C2C)OCCO4)cs1 |
| InChI | InChI=1S/C23H28N2O4S/c1-3-27-22(26)21-24-16(13-30-21)12-25-14-23(6-4-5-7-23)18-11-20-19(28-8-9-29-20)10-17(18)15(25)2/h10-11,13,15H,3-9,12,14H2,1-2H3 |
| InChIKey | UJKUCOCYRXNHCM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |