C26H26N4O3S — CID 55505381
(Z)-N-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-2-cyano-3-[1-(1-methoxypropan-2-yl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide (PubChem CID 55505381) has the molecular formula C26H26N4O3S and a molecular weight of 474.59 g/mol. Its IUPAC name is (Z)-N-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-2-cyano-3-[1-(1-methoxypropan-2-yl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide.
| Compound Name | (Z)-N-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-2-cyano-3-[1-(1-methoxypropan-2-yl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 55505381 |
| Molecular Formula | C26H26N4O3S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | (Z)-N-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-2-cyano-3-[1-(1-methoxypropan-2-yl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide |
| SMILES | COCC(C)n1c(C)cc(/C=C(/C#N)C(=O)NCc2ccc(-c3nc4ccccc4s3)o2)c1C |
| InChI | InChI=1S/C26H26N4O3S/c1-16-11-19(18(3)30(16)17(2)15-32-4)12-20(13-27)25(31)28-14-21-9-10-23(33-21)26-29-22-7-5-6-8-24(22)34-26/h5-12,17H,14-15H2,1-4H3,(H,28,31)/b20-12- |
| InChIKey | ALIJMYOYDPTSKU-NDENLUEZSA-N |
| XLogP | 5.41 |
| TPSA | 93.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|