C23H22N6O4S — CID 55507153
4-methyl-N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide (PubChem CID 55507153) has the molecular formula C23H22N6O4S and a molecular weight of 478.53 g/mol. Its IUPAC name is 4-methyl-N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide.
| Compound Name | 4-methyl-N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide |
|---|---|
| PubChem CID | 55507153 |
| Molecular Formula | C23H22N6O4S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 4-methyl-N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide |
| SMILES | Cc1cc(NC(=O)c2sc3nc4n(c(=O)c3c2C)CCCCC4)n(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C23H22N6O4S/c1-13-12-18(28(26-13)15-7-9-16(10-8-15)29(32)33)24-21(30)20-14(2)19-22(34-20)25-17-6-4-3-5-11-27(17)23(19)31/h7-10,12H,3-6,11H2,1-2H3,(H,24,30) |
| InChIKey | VTYWIQNHYXKQBH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 124.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|