C17H24BrN3O4S — CID 55508170
1-(4-bromophenyl)sulfonyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]piperidine-3-carboxamide (PubChem CID 55508170) has the molecular formula C17H24BrN3O4S and a molecular weight of 446.37 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfonyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]piperidine-3-carboxamide.
| Compound Name | 1-(4-bromophenyl)sulfonyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55508170 |
| Molecular Formula | C17H24BrN3O4S |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 1-(4-bromophenyl)sulfonyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]piperidine-3-carboxamide |
| SMILES | CC(C)NC(=O)CNC(=O)C1CCCN(S(=O)(=O)c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C17H24BrN3O4S/c1-12(2)20-16(22)10-19-17(23)13-4-3-9-21(11-13)26(24,25)15-7-5-14(18)6-8-15/h5-8,12-13H,3-4,9-11H2,1-2H3,(H,19,23)(H,20,22) |
| InChIKey | GXIDIEPISUPPIA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |