C20H26N4O3S2 — CID 55508617
2-(1-cyclopropylimidazol-2-yl)sulfanyl-N-(3-piperidin-1-ylsulfonylphenyl)propanamide (PubChem CID 55508617) has the molecular formula C20H26N4O3S2 and a molecular weight of 434.59 g/mol. Its IUPAC name is 2-(1-cyclopropylimidazol-2-yl)sulfanyl-N-(3-piperidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | 2-(1-cyclopropylimidazol-2-yl)sulfanyl-N-(3-piperidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 55508617 |
| Molecular Formula | C20H26N4O3S2 |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 2-(1-cyclopropylimidazol-2-yl)sulfanyl-N-(3-piperidin-1-ylsulfonylphenyl)propanamide |
| SMILES | CC(Sc1nccn1C1CC1)C(=O)Nc1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C20H26N4O3S2/c1-15(28-20-21-10-13-24(20)17-8-9-17)19(25)22-16-6-5-7-18(14-16)29(26,27)23-11-3-2-4-12-23/h5-7,10,13-15,17H,2-4,8-9,11-12H2,1H3,(H,22,25) |
| InChIKey | IYUARHOAFSYTIS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |