C17H16N4O4S — CID 55511974
N-cyclopropyl-2,3-dioxo-N-(pyridin-3-ylmethyl)-1,4-dihydroquinoxaline-6-sulfonamide (PubChem CID 55511974) has the molecular formula C17H16N4O4S and a molecular weight of 372.41 g/mol. Its IUPAC name is N-cyclopropyl-2,3-dioxo-N-(pyridin-3-ylmethyl)-1,4-dihydroquinoxaline-6-sulfonamide.
| Compound Name | N-cyclopropyl-2,3-dioxo-N-(pyridin-3-ylmethyl)-1,4-dihydroquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 55511974 |
| Molecular Formula | C17H16N4O4S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | N-cyclopropyl-2,3-dioxo-N-(pyridin-3-ylmethyl)-1,4-dihydroquinoxaline-6-sulfonamide |
| SMILES | O=c1[nH]c2ccc(S(=O)(=O)N(Cc3cccnc3)C3CC3)cc2[nH]c1=O |
| InChI | InChI=1S/C17H16N4O4S/c22-16-17(23)20-15-8-13(5-6-14(15)19-16)26(24,25)21(12-3-4-12)10-11-2-1-7-18-9-11/h1-2,5-9,12H,3-4,10H2,(H,19,22)(H,20,23) |
| InChIKey | YJFKRUUANJIVRI-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 115.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|