C21H30N2O5S2 — CID 55512852
methyl 1-[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 55512852) has the molecular formula C21H30N2O5S2 and a molecular weight of 454.61 g/mol. Its IUPAC name is methyl 1-[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | methyl 1-[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 55512852 |
| Molecular Formula | C21H30N2O5S2 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | methyl 1-[2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | COC(=O)C1CC2CCCCC2N1C(=O)Cc1ccc(S(=O)(=O)N2CCCCC2)s1 |
| InChI | InChI=1S/C21H30N2O5S2/c1-28-21(25)18-13-15-7-3-4-8-17(15)23(18)19(24)14-16-9-10-20(29-16)30(26,27)22-11-5-2-6-12-22/h9-10,15,17-18H,2-8,11-14H2,1H3 |
| InChIKey | LNZJTIINJYLJCK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |