C18H25F3N4O4 — CID 55518105
N-(3-methoxypropyl)-2-[4-[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]piperazin-1-yl]acetamide (PubChem CID 55518105) has the molecular formula C18H25F3N4O4 and a molecular weight of 418.42 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-[4-[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]piperazin-1-yl]acetamide.
| Compound Name | N-(3-methoxypropyl)-2-[4-[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55518105 |
| Molecular Formula | C18H25F3N4O4 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | N-(3-methoxypropyl)-2-[4-[6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]piperazin-1-yl]acetamide |
| SMILES | COCCCNC(=O)CN1CCN(C(=O)c2ccc(OCC(F)(F)F)nc2)CC1 |
| InChI | InChI=1S/C18H25F3N4O4/c1-28-10-2-5-22-15(26)12-24-6-8-25(9-7-24)17(27)14-3-4-16(23-11-14)29-13-18(19,20)21/h3-4,11H,2,5-10,12-13H2,1H3,(H,22,26) |
| InChIKey | XRVDNHJTIPXVSO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|