C23H23N3O4S2 — CID 55522105
N-[2-(4-benzylsulfonylpiperazine-1-carbonyl)phenyl]thiophene-3-carboxamide (PubChem CID 55522105) has the molecular formula C23H23N3O4S2 and a molecular weight of 469.59 g/mol. Its IUPAC name is N-[2-(4-benzylsulfonylpiperazine-1-carbonyl)phenyl]thiophene-3-carboxamide.
| Compound Name | N-[2-(4-benzylsulfonylpiperazine-1-carbonyl)phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 55522105 |
| Molecular Formula | C23H23N3O4S2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | N-[2-(4-benzylsulfonylpiperazine-1-carbonyl)phenyl]thiophene-3-carboxamide |
| SMILES | O=C(Nc1ccccc1C(=O)N1CCN(S(=O)(=O)Cc2ccccc2)CC1)c1ccsc1 |
| InChI | InChI=1S/C23H23N3O4S2/c27-22(19-10-15-31-16-19)24-21-9-5-4-8-20(21)23(28)25-11-13-26(14-12-25)32(29,30)17-18-6-2-1-3-7-18/h1-10,15-16H,11-14,17H2,(H,24,27) |
| InChIKey | LZAYYNVIKZMJBL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |