C18H19Cl4N3O2 — CID 55529164
3,4,5,6-tetrachloro-N-[2-[2-(diethylamino)ethoxy]phenyl]pyridine-2-carboxamide (PubChem CID 55529164) has the molecular formula C18H19Cl4N3O2 and a molecular weight of 451.18 g/mol. Its IUPAC name is 3,4,5,6-tetrachloro-N-[2-[2-(diethylamino)ethoxy]phenyl]pyridine-2-carboxamide.
| Compound Name | 3,4,5,6-tetrachloro-N-[2-[2-(diethylamino)ethoxy]phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 55529164 |
| Molecular Formula | C18H19Cl4N3O2 |
| Molecular Weight | 451.18 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | 3,4,5,6-tetrachloro-N-[2-[2-(diethylamino)ethoxy]phenyl]pyridine-2-carboxamide |
| SMILES | CCN(CC)CCOc1ccccc1NC(=O)c1nc(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C18H19Cl4N3O2/c1-3-25(4-2)9-10-27-12-8-6-5-7-11(12)23-18(26)16-14(20)13(19)15(21)17(22)24-16/h5-8H,3-4,9-10H2,1-2H3,(H,23,26) |
| InChIKey | XGBUZLQQUZPRJQ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.18 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|