C21H17BrN2O3S — CID 55538146
methyl 4-[[2-(4-bromophenyl)sulfanylpyridine-3-carbonyl]amino]-3-methylbenzoate (PubChem CID 55538146) has the molecular formula C21H17BrN2O3S and a molecular weight of 457.35 g/mol. Its IUPAC name is methyl 4-[[2-(4-bromophenyl)sulfanylpyridine-3-carbonyl]amino]-3-methylbenzoate.
| Compound Name | methyl 4-[[2-(4-bromophenyl)sulfanylpyridine-3-carbonyl]amino]-3-methylbenzoate |
|---|---|
| PubChem CID | 55538146 |
| Molecular Formula | C21H17BrN2O3S |
| Molecular Weight | 457.35 g/mol |
| Exact Mass | 456.01 |
| IUPAC Name | methyl 4-[[2-(4-bromophenyl)sulfanylpyridine-3-carbonyl]amino]-3-methylbenzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2cccnc2Sc2ccc(Br)cc2)c(C)c1 |
| InChI | InChI=1S/C21H17BrN2O3S/c1-13-12-14(21(26)27-2)5-10-18(13)24-19(25)17-4-3-11-23-20(17)28-16-8-6-15(22)7-9-16/h3-12H,1-2H3,(H,24,25) |
| InChIKey | SENLZLUOUKFGQE-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.35 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |