C18H13N5S2 — CID 555382
4-phenyl-5-[(4-phenyl-1,3-thiazol-2-yl)diazenyl]-1,3-thiazol-2-amine (PubChem CID 555382) has the molecular formula C18H13N5S2 and a molecular weight of 363.47 g/mol. Its IUPAC name is 4-phenyl-5-[(4-phenyl-1,3-thiazol-2-yl)diazenyl]-1,3-thiazol-2-amine.
| Compound Name | 4-phenyl-5-[(4-phenyl-1,3-thiazol-2-yl)diazenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 555382 |
| Molecular Formula | C18H13N5S2 |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 4-phenyl-5-[(4-phenyl-1,3-thiazol-2-yl)diazenyl]-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2ccccc2)c(N=Nc2nc(-c3ccccc3)cs2)s1 |
| InChI | InChI=1S/C18H13N5S2/c19-17-21-15(13-9-5-2-6-10-13)16(25-17)22-23-18-20-14(11-24-18)12-7-3-1-4-8-12/h1-11H,(H2,19,21) |
| InChIKey | SZFKCRIXDKUVBD-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 76.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|