C18H18N4O2S — CID 20581978
3-(hydroperoxymethyl)-N,N-dimethyl-4-[(4-phenyl-1,3-thiazol-2-yl)diazenyl]aniline (PubChem CID 20581978) has the molecular formula C18H18N4O2S and a molecular weight of 354.44 g/mol. Its IUPAC name is 3-(hydroperoxymethyl)-N,N-dimethyl-4-[(4-phenyl-1,3-thiazol-2-yl)diazenyl]aniline.
| Compound Name | 3-(hydroperoxymethyl)-N,N-dimethyl-4-[(4-phenyl-1,3-thiazol-2-yl)diazenyl]aniline |
|---|---|
| PubChem CID | 20581978 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 3-(hydroperoxymethyl)-N,N-dimethyl-4-[(4-phenyl-1,3-thiazol-2-yl)diazenyl]aniline |
| SMILES | CN(C)c1ccc(/N=N/c2nc(-c3ccccc3)cs2)c(COO)c1 |
| InChI | InChI=1S/C18H18N4O2S/c1-22(2)15-8-9-16(14(10-15)11-24-23)20-21-18-19-17(12-25-18)13-6-4-3-5-7-13/h3-10,12,23H,11H2,1-2H3/b21-20+ |
| InChIKey | DWPWGVQWDMHANO-QZQOTICOSA-N |
| XLogP | 5.28 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|