C20H20N2S4 — CID 11418628
1,1-bis(ethylsulfanyl)-N-[4-(4-phenylsulfanylphenyl)-1,3-thiazol-2-yl]methanimine (PubChem CID 11418628) has the molecular formula C20H20N2S4 and a molecular weight of 416.66 g/mol. Its IUPAC name is 1,1-bis(ethylsulfanyl)-N-[4-(4-phenylsulfanylphenyl)-1,3-thiazol-2-yl]methanimine.
| Compound Name | 1,1-bis(ethylsulfanyl)-N-[4-(4-phenylsulfanylphenyl)-1,3-thiazol-2-yl]methanimine |
|---|---|
| PubChem CID | 11418628 |
| Molecular Formula | C20H20N2S4 |
| Molecular Weight | 416.66 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 1,1-bis(ethylsulfanyl)-N-[4-(4-phenylsulfanylphenyl)-1,3-thiazol-2-yl]methanimine |
| SMILES | CCSC(=Nc1nc(-c2ccc(Sc3ccccc3)cc2)cs1)SCC |
| InChI | InChI=1S/C20H20N2S4/c1-3-23-20(24-4-2)22-19-21-18(14-25-19)15-10-12-17(13-11-15)26-16-8-6-5-7-9-16/h5-14H,3-4H2,1-2H3 |
| InChIKey | AGWZZKBNMBSOBO-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.66 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|