C21H18ClN3O3S2 — CID 55538311
(E)-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enamide (PubChem CID 55538311) has the molecular formula C21H18ClN3O3S2 and a molecular weight of 459.98 g/mol. Its IUPAC name is (E)-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55538311 |
| Molecular Formula | C21H18ClN3O3S2 |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | (E)-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(N2CCCS2(=O)=O)cc1)Nc1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C21H18ClN3O3S2/c22-17-7-5-16(6-8-17)19-14-29-21(23-19)24-20(26)11-4-15-2-9-18(10-3-15)25-12-1-13-30(25,27)28/h2-11,14H,1,12-13H2,(H,23,24,26)/b11-4+ |
| InChIKey | VOAQAADLAMDBCR-NYYWCZLTSA-N |
| XLogP | 4.66 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|