C25H22F4N6O — CID 55549504
N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-1-(4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 55549504) has the molecular formula C25H22F4N6O and a molecular weight of 498.48 g/mol. Its IUPAC name is N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-1-(4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-1-(4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55549504 |
| Molecular Formula | C25H22F4N6O |
| Molecular Weight | 498.48 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-1-(4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | Cc1ccc(-n2ncc(C(=O)Nc3cc(-c4nnc5n4CCCCC5)ccc3F)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H22F4N6O/c1-15-6-9-17(10-7-15)35-22(25(27,28)29)18(14-30-35)24(36)31-20-13-16(8-11-19(20)26)23-33-32-21-5-3-2-4-12-34(21)23/h6-11,13-14H,2-5,12H2,1H3,(H,31,36) |
| InChIKey | XJNAPHXXKNGVQD-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.48 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |