C24H26FN5O6 — CID 55549551
N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide (PubChem CID 55549551) has the molecular formula C24H26FN5O6 and a molecular weight of 499.50 g/mol. Its IUPAC name is N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide.
| Compound Name | N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide |
|---|---|
| PubChem CID | 55549551 |
| Molecular Formula | C24H26FN5O6 |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide |
| SMILES | COCCOc1cc([N+](=O)[O-])c(C(=O)Nc2cc(-c3nnc4n3CCCCC4)ccc2F)cc1OC |
| InChI | InChI=1S/C24H26FN5O6/c1-34-10-11-36-21-14-19(30(32)33)16(13-20(21)35-2)24(31)26-18-12-15(7-8-17(18)25)23-28-27-22-6-4-3-5-9-29(22)23/h7-8,12-14H,3-6,9-11H2,1-2H3,(H,26,31) |
| InChIKey | PFLDMVZDBHZHBV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 130.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|