C23H17ClN4O3 — CID 55578823
3-[[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]methyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione (PubChem CID 55578823) has the molecular formula C23H17ClN4O3 and a molecular weight of 432.87 g/mol. Its IUPAC name is 3-[[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]methyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione.
| Compound Name | 3-[[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]methyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 55578823 |
| Molecular Formula | C23H17ClN4O3 |
| Molecular Weight | 432.87 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 3-[[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]methyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccc3ccccc3c2)NC(=O)N(Cc2noc(-c3ccccc3Cl)n2)C1=O |
| InChI | InChI=1S/C23H17ClN4O3/c1-23(16-11-10-14-6-2-3-7-15(14)12-16)21(29)28(22(30)26-23)13-19-25-20(31-27-19)17-8-4-5-9-18(17)24/h2-12H,13H2,1H3,(H,26,30) |
| InChIKey | GGEPAPODXAWJIY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.87 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|