C24H24ClN3O3 — CID 55585752
4-chloro-N-[1-[(2-ethoxy-3-pyridinyl)methylamino]-1-oxo-3-phenylpropan-2-yl]benzamide (PubChem CID 55585752) has the molecular formula C24H24ClN3O3 and a molecular weight of 437.93 g/mol. Its IUPAC name is 4-chloro-N-[1-[(2-ethoxy-3-pyridinyl)methylamino]-1-oxo-3-phenylpropan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[1-[(2-ethoxy-3-pyridinyl)methylamino]-1-oxo-3-phenylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 55585752 |
| Molecular Formula | C24H24ClN3O3 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 4-chloro-N-[1-[(2-ethoxy-3-pyridinyl)methylamino]-1-oxo-3-phenylpropan-2-yl]benzamide |
| SMILES | CCOc1ncccc1CNC(=O)C(Cc1ccccc1)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H24ClN3O3/c1-2-31-24-19(9-6-14-26-24)16-27-23(30)21(15-17-7-4-3-5-8-17)28-22(29)18-10-12-20(25)13-11-18/h3-14,21H,2,15-16H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | NIKKJENSEUSUAG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |