C22H24FN3O2S — CID 55592510
N-[(4-cyanophenyl)methyl]-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-propylpropanamide (PubChem CID 55592510) has the molecular formula C22H24FN3O2S and a molecular weight of 413.52 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methyl]-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-propylpropanamide.
| Compound Name | N-[(4-cyanophenyl)methyl]-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-propylpropanamide |
|---|---|
| PubChem CID | 55592510 |
| Molecular Formula | C22H24FN3O2S |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | N-[(4-cyanophenyl)methyl]-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-propylpropanamide |
| SMILES | CCCN(Cc1ccc(C#N)cc1)C(=O)C(C)SCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C22H24FN3O2S/c1-3-12-26(14-18-6-4-17(13-24)5-7-18)22(28)16(2)29-15-21(27)25-20-10-8-19(23)9-11-20/h4-11,16H,3,12,14-15H2,1-2H3,(H,25,27) |
| InChIKey | DEYBUJLLLDMJKU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |