C19H17FN2O3S — CID 18207158
(4-cyanophenyl)methyl 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoate (PubChem CID 18207158) has the molecular formula C19H17FN2O3S and a molecular weight of 372.42 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoate.
| Compound Name | (4-cyanophenyl)methyl 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 18207158 |
| Molecular Formula | C19H17FN2O3S |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | (4-cyanophenyl)methyl 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylpropanoate |
| SMILES | CC(SCC(=O)Nc1ccc(F)cc1)C(=O)OCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H17FN2O3S/c1-13(19(24)25-11-15-4-2-14(10-21)3-5-15)26-12-18(23)22-17-8-6-16(20)7-9-17/h2-9,13H,11-12H2,1H3,(H,22,23) |
| InChIKey | HSGSBOXDUDTYFQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |