C18H20FN3O2S — CID 55597446
3-[[2-[(2-fluorophenyl)methylsulfanyl]ethylcarbamoylamino]methyl]benzamide (PubChem CID 55597446) has the molecular formula C18H20FN3O2S and a molecular weight of 361.44 g/mol. Its IUPAC name is 3-[[2-[(2-fluorophenyl)methylsulfanyl]ethylcarbamoylamino]methyl]benzamide.
| Compound Name | 3-[[2-[(2-fluorophenyl)methylsulfanyl]ethylcarbamoylamino]methyl]benzamide |
|---|---|
| PubChem CID | 55597446 |
| Molecular Formula | C18H20FN3O2S |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 3-[[2-[(2-fluorophenyl)methylsulfanyl]ethylcarbamoylamino]methyl]benzamide |
| SMILES | NC(=O)c1cccc(CNC(=O)NCCSCc2ccccc2F)c1 |
| InChI | InChI=1S/C18H20FN3O2S/c19-16-7-2-1-5-15(16)12-25-9-8-21-18(24)22-11-13-4-3-6-14(10-13)17(20)23/h1-7,10H,8-9,11-12H2,(H2,20,23)(H2,21,22,24) |
| InChIKey | PQXKFXVVVXTROL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|