C22H20FN3O5S — CID 55600725
ethyl 6-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylcarbamoyl]-2-methylpyridine-3-carboxylate (PubChem CID 55600725) has the molecular formula C22H20FN3O5S and a molecular weight of 457.48 g/mol. Its IUPAC name is ethyl 6-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylcarbamoyl]-2-methylpyridine-3-carboxylate.
| Compound Name | ethyl 6-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylcarbamoyl]-2-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 55600725 |
| Molecular Formula | C22H20FN3O5S |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | ethyl 6-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylcarbamoyl]-2-methylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(C(=O)NCCN2C(=O)S/C(=C\c3ccccc3F)C2=O)nc1C |
| InChI | InChI=1S/C22H20FN3O5S/c1-3-31-21(29)15-8-9-17(25-13(15)2)19(27)24-10-11-26-20(28)18(32-22(26)30)12-14-6-4-5-7-16(14)23/h4-9,12H,3,10-11H2,1-2H3,(H,24,27)/b18-12- |
| InChIKey | XGKJXRKDBMSMTM-PDGQHHTCSA-N |
| XLogP | 3.17 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|