C19H17ClN4O4S2 — CID 55602065
2-chloro-5-(dimethylsulfamoyl)-N-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]benzamide (PubChem CID 55602065) has the molecular formula C19H17ClN4O4S2 and a molecular weight of 464.96 g/mol. Its IUPAC name is 2-chloro-5-(dimethylsulfamoyl)-N-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]benzamide.
| Compound Name | 2-chloro-5-(dimethylsulfamoyl)-N-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 55602065 |
| Molecular Formula | C19H17ClN4O4S2 |
| Molecular Weight | 464.96 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | 2-chloro-5-(dimethylsulfamoyl)-N-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(Cl)c(C(=O)Nc2ccc(C(=O)Nc3nccs3)cc2)c1 |
| InChI | InChI=1S/C19H17ClN4O4S2/c1-24(2)30(27,28)14-7-8-16(20)15(11-14)18(26)22-13-5-3-12(4-6-13)17(25)23-19-21-9-10-29-19/h3-11H,1-2H3,(H,22,26)(H,21,23,25) |
| InChIKey | UNZSHVYULGFTPA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.96 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |