C20H25N7O3S — CID 55608855
2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]acetamide (PubChem CID 55608855) has the molecular formula C20H25N7O3S and a molecular weight of 443.53 g/mol. Its IUPAC name is 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]acetamide.
| Compound Name | 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 55608855 |
| Molecular Formula | C20H25N7O3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]acetamide |
| SMILES | CCC1CCC2(CC1)NC(=O)N(CC(=O)Nc1cccc(-n3nnnc3SC)c1)C2=O |
| InChI | InChI=1S/C20H25N7O3S/c1-3-13-7-9-20(10-8-13)17(29)26(18(30)22-20)12-16(28)21-14-5-4-6-15(11-14)27-19(31-2)23-24-25-27/h4-6,11,13H,3,7-10,12H2,1-2H3,(H,21,28)(H,22,30) |
| InChIKey | QAHJTQIGBNOELA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|