C22H29N3O4 — CID 55612174
2-cyclohexyl-N-(2-morpholin-4-ylpropyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 55612174) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is 2-cyclohexyl-N-(2-morpholin-4-ylpropyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-cyclohexyl-N-(2-morpholin-4-ylpropyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 55612174 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 2-cyclohexyl-N-(2-morpholin-4-ylpropyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CC(CNC(=O)c1ccc2c(c1)C(=O)N(C1CCCCC1)C2=O)N1CCOCC1 |
| InChI | InChI=1S/C22H29N3O4/c1-15(24-9-11-29-12-10-24)14-23-20(26)16-7-8-18-19(13-16)22(28)25(21(18)27)17-5-3-2-4-6-17/h7-8,13,15,17H,2-6,9-12,14H2,1H3,(H,23,26) |
| InChIKey | PJAXFXIPFNDUHW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|