C24H30N2O5S2 — CID 55613249
3-[(4-methoxyphenyl)-methylsulfamoyl]-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)benzamide (PubChem CID 55613249) has the molecular formula C24H30N2O5S2 and a molecular weight of 490.65 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)-methylsulfamoyl]-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)benzamide.
| Compound Name | 3-[(4-methoxyphenyl)-methylsulfamoyl]-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 55613249 |
| Molecular Formula | C24H30N2O5S2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 3-[(4-methoxyphenyl)-methylsulfamoyl]-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)benzamide |
| SMILES | COc1ccc(N(C)S(=O)(=O)c2cccc(C(=O)N(CC3CCCO3)C3CCSC3)c2)cc1 |
| InChI | InChI=1S/C24H30N2O5S2/c1-25(19-8-10-21(30-2)11-9-19)33(28,29)23-7-3-5-18(15-23)24(27)26(20-12-14-32-17-20)16-22-6-4-13-31-22/h3,5,7-11,15,20,22H,4,6,12-14,16-17H2,1-2H3 |
| InChIKey | NZFYVAHBUXZPOU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |