C19H25NO4S — CID 55613748
2-(3-acetylphenoxy)-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)acetamide (PubChem CID 55613748) has the molecular formula C19H25NO4S and a molecular weight of 363.48 g/mol. Its IUPAC name is 2-(3-acetylphenoxy)-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)acetamide.
| Compound Name | 2-(3-acetylphenoxy)-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 55613748 |
| Molecular Formula | C19H25NO4S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 2-(3-acetylphenoxy)-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)acetamide |
| SMILES | CC(=O)c1cccc(OCC(=O)N(CC2CCCO2)C2CCSC2)c1 |
| InChI | InChI=1S/C19H25NO4S/c1-14(21)15-4-2-5-17(10-15)24-12-19(22)20(16-7-9-25-13-16)11-18-6-3-8-23-18/h2,4-5,10,16,18H,3,6-9,11-13H2,1H3 |
| InChIKey | YJCNVAZUQZFTIP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |