C18H26N2O5S2 — CID 55613304
3-[methoxy(methyl)sulfamoyl]-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)benzamide (PubChem CID 55613304) has the molecular formula C18H26N2O5S2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 3-[methoxy(methyl)sulfamoyl]-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)benzamide.
| Compound Name | 3-[methoxy(methyl)sulfamoyl]-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 55613304 |
| Molecular Formula | C18H26N2O5S2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 3-[methoxy(methyl)sulfamoyl]-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)benzamide |
| SMILES | CON(C)S(=O)(=O)c1cccc(C(=O)N(CC2CCCO2)C2CCSC2)c1 |
| InChI | InChI=1S/C18H26N2O5S2/c1-19(24-2)27(22,23)17-7-3-5-14(11-17)18(21)20(15-8-10-26-13-15)12-16-6-4-9-25-16/h3,5,7,11,15-16H,4,6,8-10,12-13H2,1-2H3 |
| InChIKey | PKRWGQSUTNAVCH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|