C22H32N2O4S2 — CID 55613311
(E)-3-[4-(diethylsulfamoyl)phenyl]-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)prop-2-enamide (PubChem CID 55613311) has the molecular formula C22H32N2O4S2 and a molecular weight of 452.64 g/mol. Its IUPAC name is (E)-3-[4-(diethylsulfamoyl)phenyl]-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)prop-2-enamide.
| Compound Name | (E)-3-[4-(diethylsulfamoyl)phenyl]-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55613311 |
| Molecular Formula | C22H32N2O4S2 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | (E)-3-[4-(diethylsulfamoyl)phenyl]-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)prop-2-enamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/C=C/C(=O)N(CC2CCCO2)C2CCSC2)cc1 |
| InChI | InChI=1S/C22H32N2O4S2/c1-3-23(4-2)30(26,27)21-10-7-18(8-11-21)9-12-22(25)24(19-13-15-29-17-19)16-20-6-5-14-28-20/h7-12,19-20H,3-6,13-17H2,1-2H3/b12-9+ |
| InChIKey | PFZALOWKIAAUSA-FMIVXFBMSA-N |
| XLogP | 3.24 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|