C16H28N2O4S2 — CID 55613299
1-methylsulfonyl-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)piperidine-3-carboxamide (PubChem CID 55613299) has the molecular formula C16H28N2O4S2 and a molecular weight of 376.54 g/mol. Its IUPAC name is 1-methylsulfonyl-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)piperidine-3-carboxamide.
| Compound Name | 1-methylsulfonyl-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55613299 |
| Molecular Formula | C16H28N2O4S2 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 1-methylsulfonyl-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)piperidine-3-carboxamide |
| SMILES | CS(=O)(=O)N1CCCC(C(=O)N(CC2CCCO2)C2CCSC2)C1 |
| InChI | InChI=1S/C16H28N2O4S2/c1-24(20,21)17-7-2-4-13(10-17)16(19)18(14-6-9-23-12-14)11-15-5-3-8-22-15/h13-15H,2-12H2,1H3 |
| InChIKey | JYBFJMRSRZMAJE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |