C15H19N5O4S2 — CID 55619808
N'-(4-methoxypyrimidin-2-yl)-1-thiophen-2-ylsulfonylpiperidine-4-carbohydrazide (PubChem CID 55619808) has the molecular formula C15H19N5O4S2 and a molecular weight of 397.48 g/mol. Its IUPAC name is N'-(4-methoxypyrimidin-2-yl)-1-thiophen-2-ylsulfonylpiperidine-4-carbohydrazide.
| Compound Name | N'-(4-methoxypyrimidin-2-yl)-1-thiophen-2-ylsulfonylpiperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 55619808 |
| Molecular Formula | C15H19N5O4S2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | N'-(4-methoxypyrimidin-2-yl)-1-thiophen-2-ylsulfonylpiperidine-4-carbohydrazide |
| SMILES | COc1ccnc(NNC(=O)C2CCN(S(=O)(=O)c3cccs3)CC2)n1 |
| InChI | InChI=1S/C15H19N5O4S2/c1-24-12-4-7-16-15(17-12)19-18-14(21)11-5-8-20(9-6-11)26(22,23)13-3-2-10-25-13/h2-4,7,10-11H,5-6,8-9H2,1H3,(H,18,21)(H,16,17,19) |
| InChIKey | LOHKLHXKUKEKMM-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|