C24H23N5O3S2 — CID 55624883
N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide (PubChem CID 55624883) has the molecular formula C24H23N5O3S2 and a molecular weight of 493.61 g/mol. Its IUPAC name is N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide.
| Compound Name | N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
|---|---|
| PubChem CID | 55624883 |
| Molecular Formula | C24H23N5O3S2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
| SMILES | O=C(NC1CCCc2c1cnn2Cc1ccccc1)c1ccc2c(c1)SC1=NS(=O)(=O)CCN12 |
| InChI | InChI=1S/C24H23N5O3S2/c30-23(17-9-10-21-22(13-17)33-24-27-34(31,32)12-11-28(21)24)26-19-7-4-8-20-18(19)14-25-29(20)15-16-5-2-1-3-6-16/h1-3,5-6,9-10,13-14,19H,4,7-8,11-12,15H2,(H,26,30) |
| InChIKey | WDBGTFVNVHPJEW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |