C15H23N3O5S — CID 55626371
methyl 2-(2-morpholin-4-ylpropylamino)-5-sulfamoylbenzoate (PubChem CID 55626371) has the molecular formula C15H23N3O5S and a molecular weight of 357.43 g/mol. Its IUPAC name is methyl 2-(2-morpholin-4-ylpropylamino)-5-sulfamoylbenzoate.
| Compound Name | methyl 2-(2-morpholin-4-ylpropylamino)-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 55626371 |
| Molecular Formula | C15H23N3O5S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | methyl 2-(2-morpholin-4-ylpropylamino)-5-sulfamoylbenzoate |
| SMILES | COC(=O)c1cc(S(N)(=O)=O)ccc1NCC(C)N1CCOCC1 |
| InChI | InChI=1S/C15H23N3O5S/c1-11(18-5-7-23-8-6-18)10-17-14-4-3-12(24(16,20)21)9-13(14)15(19)22-2/h3-4,9,11,17H,5-8,10H2,1-2H3,(H2,16,20,21) |
| InChIKey | MAXWFULOCJNDQB-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |