C24H31N3O4S — CID 55626440
2-(3-cyclopentylsulfonylanilino)-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone (PubChem CID 55626440) has the molecular formula C24H31N3O4S and a molecular weight of 457.60 g/mol. Its IUPAC name is 2-(3-cyclopentylsulfonylanilino)-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(3-cyclopentylsulfonylanilino)-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 55626440 |
| Molecular Formula | C24H31N3O4S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 2-(3-cyclopentylsulfonylanilino)-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone |
| SMILES | COc1ccc(N2CCN(C(=O)CNc3cccc(S(=O)(=O)C4CCCC4)c3)CC2)cc1 |
| InChI | InChI=1S/C24H31N3O4S/c1-31-21-11-9-20(10-12-21)26-13-15-27(16-14-26)24(28)18-25-19-5-4-8-23(17-19)32(29,30)22-6-2-3-7-22/h4-5,8-12,17,22,25H,2-3,6-7,13-16,18H2,1H3 |
| InChIKey | USXPWWWMSOPIAN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|