C21H26N4O6 — CID 55627006
4,5-dimethoxy-N,N-dimethyl-2-[4-(4-nitroanilino)butanoylamino]benzamide (PubChem CID 55627006) has the molecular formula C21H26N4O6 and a molecular weight of 430.46 g/mol. Its IUPAC name is 4,5-dimethoxy-N,N-dimethyl-2-[4-(4-nitroanilino)butanoylamino]benzamide.
| Compound Name | 4,5-dimethoxy-N,N-dimethyl-2-[4-(4-nitroanilino)butanoylamino]benzamide |
|---|---|
| PubChem CID | 55627006 |
| Molecular Formula | C21H26N4O6 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 4,5-dimethoxy-N,N-dimethyl-2-[4-(4-nitroanilino)butanoylamino]benzamide |
| SMILES | COc1cc(NC(=O)CCCNc2ccc([N+](=O)[O-])cc2)c(C(=O)N(C)C)cc1OC |
| InChI | InChI=1S/C21H26N4O6/c1-24(2)21(27)16-12-18(30-3)19(31-4)13-17(16)23-20(26)6-5-11-22-14-7-9-15(10-8-14)25(28)29/h7-10,12-13,22H,5-6,11H2,1-4H3,(H,23,26) |
| InChIKey | PAPWAQZWGCKPFU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|