C18H21N5O6S — CID 55631351
1-methyl-N'-(3-nitrobenzoyl)-4-piperidin-1-ylsulfonylpyrrole-2-carbohydrazide (PubChem CID 55631351) has the molecular formula C18H21N5O6S and a molecular weight of 435.46 g/mol. Its IUPAC name is 1-methyl-N'-(3-nitrobenzoyl)-4-piperidin-1-ylsulfonylpyrrole-2-carbohydrazide.
| Compound Name | 1-methyl-N'-(3-nitrobenzoyl)-4-piperidin-1-ylsulfonylpyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 55631351 |
| Molecular Formula | C18H21N5O6S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 1-methyl-N'-(3-nitrobenzoyl)-4-piperidin-1-ylsulfonylpyrrole-2-carbohydrazide |
| SMILES | Cn1cc(S(=O)(=O)N2CCCCC2)cc1C(=O)NNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H21N5O6S/c1-21-12-15(30(28,29)22-8-3-2-4-9-22)11-16(21)18(25)20-19-17(24)13-6-5-7-14(10-13)23(26)27/h5-7,10-12H,2-4,8-9H2,1H3,(H,19,24)(H,20,25) |
| InChIKey | WYYYEBGUHQQBGO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 143.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|