C20H22N4O2S — CID 55632429
3-[[[2-(1-ethylbenzimidazol-2-yl)sulfanylacetyl]amino]methyl]-N-methylbenzamide (PubChem CID 55632429) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is 3-[[[2-(1-ethylbenzimidazol-2-yl)sulfanylacetyl]amino]methyl]-N-methylbenzamide.
| Compound Name | 3-[[[2-(1-ethylbenzimidazol-2-yl)sulfanylacetyl]amino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 55632429 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 3-[[[2-(1-ethylbenzimidazol-2-yl)sulfanylacetyl]amino]methyl]-N-methylbenzamide |
| SMILES | CCn1c(SCC(=O)NCc2cccc(C(=O)NC)c2)nc2ccccc21 |
| InChI | InChI=1S/C20H22N4O2S/c1-3-24-17-10-5-4-9-16(17)23-20(24)27-13-18(25)22-12-14-7-6-8-15(11-14)19(26)21-2/h4-11H,3,12-13H2,1-2H3,(H,21,26)(H,22,25) |
| InChIKey | VAINCMGLQRAQGD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |