C22H24N4O4S — CID 55635690
N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-1-(2,5-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 55635690) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-1-(2,5-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-1-(2,5-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55635690 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-1-(2,5-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccc(OC)c(N2CC(C(=O)NCCNc3nc4ccccc4s3)CC2=O)c1 |
| InChI | InChI=1S/C22H24N4O4S/c1-29-15-7-8-18(30-2)17(12-15)26-13-14(11-20(26)27)21(28)23-9-10-24-22-25-16-5-3-4-6-19(16)31-22/h3-8,12,14H,9-11,13H2,1-2H3,(H,23,28)(H,24,25) |
| InChIKey | JAOROLFCLXBXIG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|