C17H20N4O2S — CID 94144468
(3R)-N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-1-cyclopropyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 94144468) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is (3R)-N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-1-cyclopropyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-1-cyclopropyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 94144468 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (3R)-N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-1-cyclopropyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCCNc1nc2ccccc2s1)[C@@H]1CC(=O)N(C2CC2)C1 |
| InChI | InChI=1S/C17H20N4O2S/c22-15-9-11(10-21(15)12-5-6-12)16(23)18-7-8-19-17-20-13-3-1-2-4-14(13)24-17/h1-4,11-12H,5-10H2,(H,18,23)(H,19,20)/t11-/m1/s1 |
| InChIKey | FQOOKROMLOMSNR-LLVKDONJSA-N |
| XLogP | 1.84 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|