C24H28N4O2S — CID 55853347
N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-1-(3,5-dimethylbenzoyl)piperidine-3-carboxamide (PubChem CID 55853347) has the molecular formula C24H28N4O2S and a molecular weight of 436.58 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-1-(3,5-dimethylbenzoyl)piperidine-3-carboxamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-1-(3,5-dimethylbenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55853347 |
| Molecular Formula | C24H28N4O2S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-1-(3,5-dimethylbenzoyl)piperidine-3-carboxamide |
| SMILES | Cc1cc(C)cc(C(=O)N2CCCC(C(=O)NCCNc3nc4ccccc4s3)C2)c1 |
| InChI | InChI=1S/C24H28N4O2S/c1-16-12-17(2)14-19(13-16)23(30)28-11-5-6-18(15-28)22(29)25-9-10-26-24-27-20-7-3-4-8-21(20)31-24/h3-4,7-8,12-14,18H,5-6,9-11,15H2,1-2H3,(H,25,29)(H,26,27) |
| InChIKey | SBEOVULNSSUKRV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|