C16H23ClN4OS — CID 120632639
(2S,4S)-N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-methylpiperidine-4-carboxamide;hydrochloride (PubChem CID 120632639) has the molecular formula C16H23ClN4OS and a molecular weight of 354.91 g/mol. Its IUPAC name is (2S,4S)-N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-methylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | (2S,4S)-N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-methylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120632639 |
| Molecular Formula | C16H23ClN4OS |
| Molecular Weight | 354.91 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | (2S,4S)-N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-methylpiperidine-4-carboxamide;hydrochloride |
| SMILES | C[C@H]1C[C@@H](C(=O)NCCNc2nc3ccccc3s2)CCN1.Cl |
| InChI | InChI=1S/C16H22N4OS.ClH/c1-11-10-12(6-7-17-11)15(21)18-8-9-19-16-20-13-4-2-3-5-14(13)22-16;/h2-5,11-12,17H,6-10H2,1H3,(H,18,21)(H,19,20);1H/t11-,12-;/m0./s1 |
| InChIKey | XAHSHLLMTCAQBO-FXMYHANSSA-N |
| XLogP | 2.63 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.91 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|