C16H17FN2O6S — CID 55644118
[1-[(3-fluorophenyl)methyl-methylamino]-1-oxopropan-2-yl] 5-sulfamoylfuran-2-carboxylate (PubChem CID 55644118) has the molecular formula C16H17FN2O6S and a molecular weight of 384.39 g/mol. Its IUPAC name is [1-[(3-fluorophenyl)methyl-methylamino]-1-oxopropan-2-yl] 5-sulfamoylfuran-2-carboxylate.
| Compound Name | [1-[(3-fluorophenyl)methyl-methylamino]-1-oxopropan-2-yl] 5-sulfamoylfuran-2-carboxylate |
|---|---|
| PubChem CID | 55644118 |
| Molecular Formula | C16H17FN2O6S |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | [1-[(3-fluorophenyl)methyl-methylamino]-1-oxopropan-2-yl] 5-sulfamoylfuran-2-carboxylate |
| SMILES | CC(OC(=O)c1ccc(S(N)(=O)=O)o1)C(=O)N(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C16H17FN2O6S/c1-10(15(20)19(2)9-11-4-3-5-12(17)8-11)24-16(21)13-6-7-14(25-13)26(18,22)23/h3-8,10H,9H2,1-2H3,(H2,18,22,23) |
| InChIKey | PODRMAIOXCQBCN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 119.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |