C18H16FN3O4 — CID 55646692
[1-(2-fluoroanilino)-1-oxopropan-2-yl] 5-(pyrazol-1-ylmethyl)furan-2-carboxylate (PubChem CID 55646692) has the molecular formula C18H16FN3O4 and a molecular weight of 357.34 g/mol. Its IUPAC name is [1-(2-fluoroanilino)-1-oxopropan-2-yl] 5-(pyrazol-1-ylmethyl)furan-2-carboxylate.
| Compound Name | [1-(2-fluoroanilino)-1-oxopropan-2-yl] 5-(pyrazol-1-ylmethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 55646692 |
| Molecular Formula | C18H16FN3O4 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | [1-(2-fluoroanilino)-1-oxopropan-2-yl] 5-(pyrazol-1-ylmethyl)furan-2-carboxylate |
| SMILES | CC(OC(=O)c1ccc(Cn2cccn2)o1)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C18H16FN3O4/c1-12(17(23)21-15-6-3-2-5-14(15)19)25-18(24)16-8-7-13(26-16)11-22-10-4-9-20-22/h2-10,12H,11H2,1H3,(H,21,23) |
| InChIKey | WTLASBAMDCAVRO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |